1-Propanol, 3-(methylnitrosoamino)-, 4-methylbenzenesulfonate (ester)
Modify Date: 2025-09-25 10:40:09
1-Propanol, 3-(methylnitrosoamino)-, 4-methylbenzenesulfonate (ester) structure
|
Common Name | 1-Propanol, 3-(methylnitrosoamino)-, 4-methylbenzenesulfonate (ester) | ||
|---|---|---|---|---|
| CAS Number | 66398-65-0 | Molecular Weight | 272.32100 | |
| Density | 1.24g/cm3 | Boiling Point | 470.6ºC at 760 mmHg | |
| Molecular Formula | C11H16N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.4ºC | |
| Name | 1-Propanol, 3-(methylnitrosoamino)-, 4-methylbenzenesulfonate (ester) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 470.6ºC at 760 mmHg |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.32100 |
| Flash Point | 238.4ºC |
| Exact Mass | 272.08300 |
| PSA | 84.42000 |
| LogP | 2.78440 |
| Index of Refraction | 1.545 |
| InChIKey | COCFCYNGJGKXSR-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCCN(C)N=O)cc1 |
| HS Code | 2922199090 |
|---|
|
~%
1-Propanol, 3-(... CAS#:66398-65-0 |
| Literature: Koepke,S.R. et al. Journal of Organic Chemistry, 1979 , vol. 44, # 15 p. 2718 - 2722 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-methyl-N-neopentylthiourea |