L-Alanine,N-[N-methyl-N-[(phenylmethoxy)carbonyl]glycyl]- (9CI) structure
|
Common Name | L-Alanine,N-[N-methyl-N-[(phenylmethoxy)carbonyl]glycyl]- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 66378-07-2 | Molecular Weight | 294.30300 | |
| Density | 1.263g/cm3 | Boiling Point | 538.6ºC at 760mmHg | |
| Molecular Formula | C14H18N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 279.6ºC | |
| Name | 2-[[2-[methyl(phenylmethoxycarbonyl)amino]acetyl]amino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.263g/cm3 |
|---|---|
| Boiling Point | 538.6ºC at 760mmHg |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.30300 |
| Flash Point | 279.6ºC |
| Exact Mass | 294.12200 |
| PSA | 95.94000 |
| LogP | 1.23520 |
| Index of Refraction | 1.55 |
| InChIKey | RRUKEZSOGQBOIY-UHFFFAOYSA-N |
| SMILES | CC(NC(=O)CN(C)C(=O)OCc1ccccc1)C(=O)O |
|
~%
L-Alanine,N-[N-... CAS#:66378-07-2 |
| Literature: Okada; Iguchi; Okinaka; Yagyu; Sano; Otani Chemical and Pharmaceutical Bulletin, 1978 , vol. 26, # 11 p. 3588 - 3591 |
|
~%
L-Alanine,N-[N-... CAS#:66378-07-2 |
| Literature: Titlestad,K. Acta Chemica Scandinavica, Series B: Organic Chemistry and Biochemistry, 1977 , vol. 31, p. 641 - 661 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| carbobenzyloxysarcosyl-l-alanine |