1-[(2-chlorophenyl)amino]cyclopentane-1-carboxylic acid structure
|
Common Name | 1-[(2-chlorophenyl)amino]cyclopentane-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 6636-90-4 | Molecular Weight | 239.69800 | |
| Density | 1.359g/cm3 | Boiling Point | 417.1ºC at 760 mmHg | |
| Molecular Formula | C12H14ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.1ºC | |
| Name | 1-(2-chloroanilino)cyclopentane-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.359g/cm3 |
|---|---|
| Boiling Point | 417.1ºC at 760 mmHg |
| Molecular Formula | C12H14ClNO2 |
| Molecular Weight | 239.69800 |
| Flash Point | 206.1ºC |
| Exact Mass | 239.07100 |
| PSA | 49.33000 |
| LogP | 3.22230 |
| Index of Refraction | 1.635 |
| InChIKey | KGTGFSQKNNUILP-UHFFFAOYSA-N |
| SMILES | O=C(O)C1(Nc2ccccc2Cl)CCCC1 |
|
~%
1-[(2-chlorophe... CAS#:6636-90-4 |
| Literature: Oakeshott; Plant Journal of the Chemical Society, 1927 , p. 486 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| hms3089c07 |