CHEMBRDG-BB 6147652
Modify Date: 2025-08-27 12:30:49
CHEMBRDG-BB 6147652 structure
|
Common Name | CHEMBRDG-BB 6147652 | ||
|---|---|---|---|---|
| CAS Number | 66346-53-0 | Molecular Weight | 218.24800 | |
| Density | 1.186g/cm3 | Boiling Point | 390.2ºC at 760 mmHg | |
| Molecular Formula | C13H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.7ºC | |
| Name | 5-hydroxy-7-methyl-4-propylchromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.186g/cm3 |
|---|---|
| Boiling Point | 390.2ºC at 760 mmHg |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.24800 |
| Flash Point | 169.7ºC |
| Exact Mass | 218.09400 |
| PSA | 50.44000 |
| LogP | 2.75950 |
| Index of Refraction | 1.571 |
| InChIKey | WMSVQPRIONJUIS-UHFFFAOYSA-N |
| SMILES | CCCc1cc(=O)oc2cc(C)cc(O)c12 |
| HS Code | 2932209090 |
|---|
|
~%
CHEMBRDG-BB 6147652 CAS#:66346-53-0 |
| Literature: Kotwani et al. Proceedings - Indian Academy of Sciences, Section A, 1942 , # 15 p. 441,443 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932209090 |
|---|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-hydroxy-7-methyl-4-propyl-chromen-2-one |
| 5-hydroxy-7-methyl-4-propyl-2H-chromen-2-one |
| 5-Hydroxy-7-methyl-4-propyl-cumarin |
| 5-hydroxy-7-methyl-4-propylcoumarin |