3-Desacetyl Cefotaxime Lactone
Modify Date: 2025-09-03 09:56:47
3-Desacetyl Cefotaxime Lactone structure
|
Common Name | 3-Desacetyl Cefotaxime Lactone | ||
|---|---|---|---|---|
| CAS Number | 66340-33-8 | Molecular Weight | 395.414 | |
| Density | 2.0±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H13N5O5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 3-Desacetyl Cefotaxime Lactone3-Desacetyl Cefotaxime lactone is the active metabolite of Cefotaxime. Cefotaxime sodium salt is a third-generation cephalosporin antibiotic. |
| Name | 3-Desacetyl Cefotaxime Lactone |
|---|---|
| Synonym | More Synonyms |
| Description | 3-Desacetyl Cefotaxime lactone is the active metabolite of Cefotaxime. Cefotaxime sodium salt is a third-generation cephalosporin antibiotic. |
|---|---|
| Related Catalog | |
| References |
| Density | 2.0±0.1 g/cm3 |
|---|---|
| Molecular Formula | C14H13N5O5S2 |
| Molecular Weight | 395.414 |
| Exact Mass | 395.035797 |
| PSA | 193.97000 |
| LogP | -0.75 |
| Index of Refraction | 1.904 |
| InChIKey | MCSWUKXFFGUOQE-HYPSZOGVSA-N |
| SMILES | CON=C(C(=O)NC1C(=O)N2C3=C(COC3=O)CSC12)c1csc(N)n1 |
| RIDADR | NONH for all modes of transport |
|---|
| (2Z)-2-(2-Amino-1,3-thiazol-4-yl)-N-[(5aR,6R)-1,7-dioxo-1,4,6,7-tetrahydro-3H,5aH-azeto[2,1-b]furo[3,4-d][1,3]thiazin-6-yl]-2-(methoxyimino)acetamide |
| [5aR-[5a|A,6|A(Z)]]-2-Amino-|A-(methoxyimino)-N-(1,4,5a,6-tetrahydro-1,7-dioxo-3H,7H-azeto[2,1-b]furo[3,4-d][1,3]thiazin-6-yl)-4-thiazoleacetamide |
| UNII-3Z40JM5X8L |
| 4-Thiazoleacetamide, 2-amino-α-(methoxyimino)-N-[(5aR,6R)-1,4,5a,6-tetrahydro-1,7-dioxo-3H,7H-azeto[2,1-b]furo[3,4-d][1,3]thiazin-6-yl]-, (αZ)- |
| Cefotaxime EP Impurity E |
| Cefotaxime Impurity 5 |