9H-fluoren-9-yl-trimethyl-azanium
Modify Date: 2025-08-20 22:39:57
9H-fluoren-9-yl-trimethyl-azanium structure
|
Common Name | 9H-fluoren-9-yl-trimethyl-azanium | ||
|---|---|---|---|---|
| CAS Number | 6634-60-2 | Molecular Weight | 304.22500 | |
| Density | 1.177g/cm3 | Boiling Point | 461.6ºC at 760 mmHg | |
| Molecular Formula | C16H18BrN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233ºC | |
| Name | N-(9-fluorenyl)trimethylammonium bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.177g/cm3 |
|---|---|
| Boiling Point | 461.6ºC at 760 mmHg |
| Molecular Formula | C16H18BrN |
| Molecular Weight | 304.22500 |
| Flash Point | 233ºC |
| Exact Mass | 303.06200 |
| LogP | 0.46660 |
| Index of Refraction | 1.603 |
| InChIKey | LCHMAZCIVWCCEL-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)C1c2ccccc2-c2ccccc21.[Br-] |
|
~%
9H-fluoren-9-yl... CAS#:6634-60-2 |
| Literature: Ingold; Jessop Journal of the Chemical Society, 1929 , p. 2361 |
|
~%
9H-fluoren-9-yl... CAS#:6634-60-2 |
| Literature: Wittig; Felletschin Justus Liebigs Annalen der Chemie, 1944 , vol. 555, p. 133,137,144 |
|
~%
9H-fluoren-9-yl... CAS#:6634-60-2 |
| Literature: Ingold; Jessop Journal of the Chemical Society, 1929 , p. 2361 |
CAS#:746-47-4
CAS#:53156-46-0
CAS#:31859-93-5| fluoren-9-yl-trimethyl-ammonium,bromide |
| fluoren-9-yl-succinic acid |
| 2-(9H-fluoren-9-yl)succinic acid |
| Fluorene-9-succinic acid |
| Fluoren-9-yl-bernsteinsaeure |
| Fluoren-9-yl-trimethyl-ammonium,Bromid |
| (9-Fluorenyl)trimethylammoniumbromid |