1,2-Benzenedicarboxylicacid, 3-nitro-, 2-[2-(diethylamino)ethyl] ester structure
|
Common Name | 1,2-Benzenedicarboxylicacid, 3-nitro-, 2-[2-(diethylamino)ethyl] ester | ||
|---|---|---|---|---|
| CAS Number | 6634-21-5 | Molecular Weight | 310.30300 | |
| Density | 1.284g/cm3 | Boiling Point | 459.9ºC at 760mmHg | |
| Molecular Formula | C14H18N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.9ºC | |
| Name | 2-[2-(diethylamino)ethoxycarbonyl]-3-nitrobenzoic acid |
|---|
| Density | 1.284g/cm3 |
|---|---|
| Boiling Point | 459.9ºC at 760mmHg |
| Molecular Formula | C14H18N2O6 |
| Molecular Weight | 310.30300 |
| Flash Point | 231.9ºC |
| Exact Mass | 310.11600 |
| PSA | 112.66000 |
| LogP | 2.31480 |
| Index of Refraction | 1.562 |
| InChIKey | UHDVUPXSYOZLOA-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOC(=O)c1c(C(=O)O)cccc1[N+](=O)[O-] |
|
~%
1,2-Benzenedica... CAS#:6634-21-5 |
| Literature: Blicke; Otsuki Journal of the American Chemical Society, 1941 , vol. 63, p. 1945 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |