2-chloro-1-methylindole-3,5-dicarbaldehyde structure
|
Common Name | 2-chloro-1-methylindole-3,5-dicarbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 66335-32-8 | Molecular Weight | 221.64000 | |
| Density | 1.33g/cm3 | Boiling Point | 416.8ºC at 760mmHg | |
| Molecular Formula | C11H8ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.8ºC | |
| Name | 2-chloro-1-methylindole-3,5-dicarbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 416.8ºC at 760mmHg |
| Molecular Formula | C11H8ClNO2 |
| Molecular Weight | 221.64000 |
| Flash Point | 205.8ºC |
| Exact Mass | 221.02400 |
| PSA | 39.07000 |
| LogP | 2.45670 |
| Index of Refraction | 1.616 |
| InChIKey | DZHRMXYXRVSNFD-UHFFFAOYSA-N |
| SMILES | Cn1c(Cl)c(C=O)c2cc(C=O)ccc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-chloro-1-methyl-1H-indole-3,5-dicarbaldehyde |