1,5-Pentanediamine,N1-(1,1-dimethylpropyl)-N5-(6-methoxy-8-quinolinyl)- structure
|
Common Name | 1,5-Pentanediamine,N1-(1,1-dimethylpropyl)-N5-(6-methoxy-8-quinolinyl)- | ||
|---|---|---|---|---|
| CAS Number | 6633-02-9 | Molecular Weight | 329.48000 | |
| Density | 1.037g/cm3 | Boiling Point | 490.4ºC at 760 mmHg | |
| Molecular Formula | C20H31N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.4ºC | |
| Name | N-(6-methoxyquinolin-8-yl)-N'-(2-methylbutan-2-yl)pentane-1,5-diamine |
|---|
| Density | 1.037g/cm3 |
|---|---|
| Boiling Point | 490.4ºC at 760 mmHg |
| Molecular Formula | C20H31N3O |
| Molecular Weight | 329.48000 |
| Flash Point | 250.4ºC |
| Exact Mass | 329.24700 |
| PSA | 46.18000 |
| LogP | 5.06770 |
| Index of Refraction | 1.566 |
| InChIKey | XDRINNYGTWOXIX-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)NCCCCCNc1cc(OC)cc2cccnc12 |
|
~%
1,5-Pentanediam... CAS#:6633-02-9 |
| Literature: Drake et al. Journal of the American Chemical Society, 1946 , vol. 68, p. 1529 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |