Ethanone,1-(9-bromo-3-phenanthrenyl)-, oxime structure
|
Common Name | Ethanone,1-(9-bromo-3-phenanthrenyl)-, oxime | ||
|---|---|---|---|---|
| CAS Number | 6632-92-4 | Molecular Weight | 314.17700 | |
| Density | 1.43g/cm3 | Boiling Point | 502.1ºC at 760 mmHg | |
| Molecular Formula | C16H12BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.5ºC | |
| Name | N-[1-(9-bromophenanthren-3-yl)ethylidene]hydroxylamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 502.1ºC at 760 mmHg |
| Molecular Formula | C16H12BrNO |
| Molecular Weight | 314.17700 |
| Flash Point | 257.5ºC |
| Exact Mass | 313.01000 |
| PSA | 32.59000 |
| LogP | 4.95370 |
| Index of Refraction | 1.652 |
| InChIKey | MNNDVSWQIULTHP-UHFFFAOYSA-N |
| SMILES | CC(=NO)c1ccc2cc(Br)c3ccccc3c2c1 |
| HS Code | 2928000090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 3-Acetyl-9-bromophenanthrene |
| 3-Acetyl-9-brom-phenanthren |