6-Chloro-5-nitrouracil structure
|
Common Name | 6-Chloro-5-nitrouracil | ||
|---|---|---|---|---|
| CAS Number | 6630-30-4 | Molecular Weight | 191.53 | |
| Density | 1.85±0.1 g/cm3 | Boiling Point | 469.3ºC at 760 mmHg | |
| Molecular Formula | C4H2ClN3O4 | Melting Point | 220-222 ºC | |
| MSDS | N/A | Flash Point | 237.6ºC | |
| Name | 6-Chloro-5-nitropyrimidine-2,4(1H,3H)-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.85±0.1 g/cm3 |
|---|---|
| Boiling Point | 469.3ºC at 760 mmHg |
| Melting Point | 220-222 ºC |
| Molecular Formula | C4H2ClN3O4 |
| Molecular Weight | 191.53 |
| Flash Point | 237.6ºC |
| PSA | 112.06000 |
| LogP | 0.97260 |
| Index of Refraction | 1.621 |
| InChIKey | GPFMSTOIHBOPQA-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(Cl)c([N+](=O)[O-])c(=O)[nH]1 |
| Storage condition | 2-8°C |
| Water Solubility | Slightly soluble (1.7 g/L) (25 ºC) |
| HS Code | 2933599090 |
|---|
|
~60%
6-Chloro-5-nitr... CAS#:6630-30-4 |
| Literature: Al-Hassan, Saieba S.; Kulick, Russell J; Livingstone, Daniel B.; Suckling, Colin J.; Wood, Hamish C. S.; et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 2645 - 2656 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-chloro-5-nitro-1H-pyrimidine-2,4-dione |
| 6-Chloro-5-Nitropyrimidine-2,4-Diol |
| 6-Chloro-5-nitrouracil |