3-nitropropylsulfonylbenzene structure
|
Common Name | 3-nitropropylsulfonylbenzene | ||
|---|---|---|---|---|
| CAS Number | 66291-13-2 | Molecular Weight | 229.25300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-nitropropylsulfonylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H11NO4S |
|---|---|
| Molecular Weight | 229.25300 |
| Exact Mass | 229.04100 |
| PSA | 88.34000 |
| LogP | 2.73110 |
| InChIKey | LXNBJOKSGLKWFO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])CCCS(=O)(=O)c1ccccc1 |
|
~%
3-nitropropylsu... CAS#:66291-13-2 |
| Literature: Bordwell,F.G.; Bartmess,J.E. Journal of Organic Chemistry, 1978 , vol. 43, p. 3101 - 3107 |
|
~%
3-nitropropylsu... CAS#:66291-13-2 |
| Literature: Bordwell,F.G.; Bartmess,J.E. Journal of Organic Chemistry, 1978 , vol. 43, p. 3101 - 3107 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-(phenylsulfonyl)-1-nitropropane |
| Benzene,[(3-nitropropyl)sulfonyl] |
| 3-Phenylsulfonyl-1-nitropropan |