1,4-Dioxane,2,2,3,3,5,5,6-heptachloro- structure
|
Common Name | 1,4-Dioxane,2,2,3,3,5,5,6-heptachloro- | ||
|---|---|---|---|---|
| CAS Number | 6629-96-5 | Molecular Weight | 329.22100 | |
| Density | 1.91g/cm3 | Boiling Point | 318ºC at 760mmHg | |
| Molecular Formula | C4HCl7O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 124.8ºC | |
| Name | 2,2,3,3,5,5,6-heptachloro-1,4-dioxane |
|---|
| Density | 1.91g/cm3 |
|---|---|
| Boiling Point | 318ºC at 760mmHg |
| Molecular Formula | C4HCl7O2 |
| Molecular Weight | 329.22100 |
| Flash Point | 124.8ºC |
| Exact Mass | 325.78000 |
| PSA | 18.46000 |
| LogP | 3.99230 |
| Index of Refraction | 1.562 |
| InChIKey | QESFVSBDBUGOEW-UHFFFAOYSA-N |
| SMILES | ClC1OC(Cl)(Cl)C(Cl)(Cl)OC1(Cl)Cl |
|
~50%
1,4-Dioxane,2,2... CAS#:6629-96-5 |
| Literature: Krespan, Carl G.; Dixon, David A. Journal of Organic Chemistry, 1991 , vol. 56, # 12 p. 3915 - 3923 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |