naphthalen-2-ylsulfanyl-(4-nitrophenyl)methanone
Modify Date: 2025-08-25 13:22:08
naphthalen-2-ylsulfanyl-(4-nitrophenyl)methanone structure
|
Common Name | naphthalen-2-ylsulfanyl-(4-nitrophenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 6629-65-8 | Molecular Weight | 309.33900 | |
| Density | 1.38g/cm3 | Boiling Point | 501.4ºC at 760 mmHg | |
| Molecular Formula | C17H11NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257ºC | |
| Name | S-naphthalen-2-yl 4-nitrobenzenecarbothioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 501.4ºC at 760 mmHg |
| Molecular Formula | C17H11NO3S |
| Molecular Weight | 309.33900 |
| Flash Point | 257ºC |
| Exact Mass | 309.04600 |
| PSA | 88.19000 |
| LogP | 5.20370 |
| Index of Refraction | 1.717 |
| InChIKey | RODSKYWDDTXFIC-UHFFFAOYSA-N |
| SMILES | O=C(Sc1ccc2ccccc2c1)c1ccc([N+](=O)[O-])cc1 |
|
~%
naphthalen-2-yl... CAS#:6629-65-8 |
| Literature: Pittelkow, Michael; Kamounah, Fadhil S.; Boas, Ulrik; Pedersen, Brian; Christensen, Jorn B. Synthesis, 2004 , # 15 p. 2485 - 2492 |
|
~%
naphthalen-2-yl... CAS#:6629-65-8 |
| Literature: Grillot et al. Journal of the American Chemical Society, 1950 , vol. 72, p. 1863 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-nitro-thiobenzoic acid S-[2]naphthyl ester |
| S-2-naphthyl 4-nitrobenzenecarbothioate |
| NAPHTHALEN-2-YLSULFANYL-(4-NITROPHENYL)METHANONE |
| 4-Nitro-thiobenzoesaeure-S-[2]naphthylester |