bis(1-octan-2-yloxycarbonylethyl) hexanedioate
Modify Date: 2025-09-14 09:55:33
bis(1-octan-2-yloxycarbonylethyl) hexanedioate structure
|
Common Name | bis(1-octan-2-yloxycarbonylethyl) hexanedioate | ||
|---|---|---|---|---|
| CAS Number | 6628-72-4 | Molecular Weight | 514.69200 | |
| Density | 1.016g/cm3 | Boiling Point | 552.3ºC at 760 mmHg | |
| Molecular Formula | C28H50O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.4ºC | |
| Name | bis(1-octan-2-yloxy-1-oxopropan-2-yl) hexanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.016g/cm3 |
|---|---|
| Boiling Point | 552.3ºC at 760 mmHg |
| Molecular Formula | C28H50O8 |
| Molecular Weight | 514.69200 |
| Flash Point | 227.4ºC |
| Exact Mass | 514.35100 |
| PSA | 105.20000 |
| LogP | 6.21440 |
| Index of Refraction | 1.46 |
| InChIKey | ZSNKERFBKVLEPN-UHFFFAOYSA-N |
| SMILES | CCCCCCC(C)OC(=O)C(C)OC(=O)CCCCC(=O)OC(C)C(=O)OC(C)CCCCCC |
|
~%
bis(1-octan-2-y... CAS#:6628-72-4 |
| Literature: Rehberg; Dixon Journal of the American Chemical Society, 1950 , vol. 72, p. 5757 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| adipic acid bis-[1-(1-methyl-heptyloxycarbonyl)-ethyl ester] |
| 2,11-Dimethyl-4,9-dioxo-3,10-dioxa-dodecandisaeure-bis-(1-methyl-heptylester) |
| bis[1-(octan-2-yloxy)-1-oxopropan-2-yl] hexanedioate |
| Adipinsaeure-bis-[1-(1-methyl-heptyloxycarbonyl)-aethylester] |