2,2,2-TRICHLORO-1,1-DIMETHYLETHYL CHLOROFORMATE structure
|
Common Name | 2,2,2-TRICHLORO-1,1-DIMETHYLETHYL CHLOROFORMATE | ||
|---|---|---|---|---|
| CAS Number | 66270-36-8 | Molecular Weight | 239.91200 | |
| Density | 1.497g/cm3 | Boiling Point | 83-84ºC14 mm Hg(lit.) | |
| Molecular Formula | C5H6Cl4O2 | Melting Point | 28-30ºC(lit.) | |
| MSDS | USA | Flash Point | 86.1ºC | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
| Name | (1,1,1-trichloro-2-methylpropan-2-yl) carbonochloridate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.497g/cm3 |
|---|---|
| Boiling Point | 83-84ºC14 mm Hg(lit.) |
| Melting Point | 28-30ºC(lit.) |
| Molecular Formula | C5H6Cl4O2 |
| Molecular Weight | 239.91200 |
| Flash Point | 86.1ºC |
| Exact Mass | 237.91200 |
| PSA | 26.30000 |
| LogP | 3.51060 |
| Index of Refraction | 1.49 |
| InChIKey | GMELMFSDPDSXOZ-UHFFFAOYSA-N |
| SMILES | CC(C)(OC(=O)Cl)C(Cl)(Cl)Cl |
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 + H311 + H331-H314 |
| Precautionary Statements | P261-P280-P301 + P310-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Phrases | 23/24/25-34 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 2928 6.1/PG 2 |
| Packaging Group | II |
| Hazard Class | 6.1(a) |
| HS Code | 2915900090 |
|
~%
2,2,2-TRICHLORO... CAS#:66270-36-8 |
| Literature: Eckert,H. et al. Angewandte Chemie, 1978 , vol. 90, p. 388 - 389 |
|
~88%
2,2,2-TRICHLORO... CAS#:66270-36-8 |
| Literature: Eckert, Heiner; Forster, Barbara Angewandte Chemie, 1987 , vol. 99, # 9 p. 922 - 923 |
|
~4%
2,2,2-TRICHLORO... CAS#:66270-36-8 |
| Literature: Kamimura, Takashi; Masegi, Tsukio; Urakami, Ken-ichi; Honda, Shinkichi; Sekine, Mitsuo; Hata, Tsujiaki Chemistry Letters, 1983 , p. 1051 - 1054 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
|
Kinetic studies of the solvolyses of 2, 2, 2-trichloro-1, 1-dimethylethyl chloroformate.
Bull. Korean Chem. Soc. 31(4) , 835, (2010)
|
| 1,1-dimethyl-2,2,2-trichloroethyl chloroformate |
| 2,2':5',2''-TERTHIOPHENE-5-BORONIC ACID PINACOL ESTER |
| 2,2,2-trichloro-tert-butyl chloroformate |
| MFCD00000801 |
| TCBoc-chloride |
| EINECS 266-293-4 |
| 2,2,2-trichloro-tert-butoxycarbonyl chloride |
| 2,2,2-Trichloro-1,1-dimethylethyl chloroformate |
| 1,1-dimethyl-2,2,2-trichloro-ethoxycarbonyl chloride |