17-(1H-Imidazol-4-yl)androst-5-en-3-ol structure
|
Common Name | 17-(1H-Imidazol-4-yl)androst-5-en-3-ol | ||
|---|---|---|---|---|
| CAS Number | 6626-60-4 | Molecular Weight | 340.50200 | |
| Density | 1.16g/cm3 | Boiling Point | 542.9ºC at 760 mmHg | |
| Molecular Formula | C22H32N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 282.1ºC | |
| Name | 17-(1H-imidazol-5-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 542.9ºC at 760 mmHg |
| Molecular Formula | C22H32N2O |
| Molecular Weight | 340.50200 |
| Flash Point | 282.1ºC |
| Exact Mass | 340.25100 |
| PSA | 48.91000 |
| LogP | 4.81700 |
| Index of Refraction | 1.595 |
| InChIKey | BBUJYEQSYYZBDG-UHFFFAOYSA-N |
| SMILES | CC12CCC(O)CC1=CCC1C2CCC2(C)C(c3cnc[nH]3)CCC12 |
|
~28%
17-(1H-Imidazol... CAS#:6626-60-4 |
| Literature: Ling, Yang-Zhi; Li, Ji-Song; Liu, Yang; Kato, Katsuya; Klus, Gregory T.; Brodie, Angela Journal of Medicinal Chemistry, 1997 , vol. 40, # 20 p. 3297 - 3304 |
|
~%
17-(1H-Imidazol... CAS#:6626-60-4 |
| Literature: Searle and Co. Patent: US2664423 , 1952 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (3|A,17|A)-17-(1h-pyrazol-5-yl)androst-5-en-3-ol |