6-methylheptyl prop-2-enoate,2-methylprop-2-enoic acid,styrene
Modify Date: 2025-08-25 12:01:16
6-methylheptyl prop-2-enoate,2-methylprop-2-enoic acid,styrene structure
|
Common Name | 6-methylheptyl prop-2-enoate,2-methylprop-2-enoic acid,styrene | ||
|---|---|---|---|---|
| CAS Number | 66251-45-4 | Molecular Weight | 374.51400 | |
| Density | N/A | Boiling Point | 227.7ºC at 760mmHg | |
| Molecular Formula | C23H34O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-methylheptyl prop-2-enoate,2-methylprop-2-enoic acid,styrene |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 227.7ºC at 760mmHg |
|---|---|
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.51400 |
| Exact Mass | 374.24600 |
| PSA | 63.60000 |
| LogP | 5.90870 |
| InChIKey | WAVAIRZAEWOAJL-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)O.C=CC(=O)OCCCCCC(C)C.C=Cc1ccccc1 |
| 2-Propenoic acid,polymer with ethenylbenzene and isooctyl 2-propenoate |
| Ethenylbenzene,2-propenoic acid,2-propenoic acid,isooctyl ester polymer |