ethenyl acetate,6-methylheptyl prop-2-enoate,2-methylprop-2-enoic acid
Modify Date: 2025-08-22 17:23:19
ethenyl acetate,6-methylheptyl prop-2-enoate,2-methylprop-2-enoic acid structure
|
Common Name | ethenyl acetate,6-methylheptyl prop-2-enoate,2-methylprop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 66251-44-3 | Molecular Weight | 356.45400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H32O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethenyl acetate,6-methylheptyl prop-2-enoate,2-methylprop-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H32O6 |
|---|---|
| Molecular Weight | 356.45400 |
| Exact Mass | 356.22000 |
| PSA | 89.90000 |
| LogP | 4.27210 |
| InChIKey | AUMHUHPIRBJGPE-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)O.C=CC(=O)OCCCCCC(C)C.C=COC(C)=O |
| 2-Propenoic acid,polymer with ethenyl acetate and isooctyl 2-propenoate |
| Acetic acid,ethenyl ester,2-propenoic acid,2-propenoic acid,isooctyl ester polymer |
| Acetic acid,ethenyl ester,polymer with 2-propenoic acid and 2-propenoic acid,isooctyl ester |