2-chloro-6-[[(3-chloro-2-hydroxy-5-methyl-phenyl)methyl-cyclohexyl-amino]methyl]-4-methyl-phenol structure
|
Common Name | 2-chloro-6-[[(3-chloro-2-hydroxy-5-methyl-phenyl)methyl-cyclohexyl-amino]methyl]-4-methyl-phenol | ||
|---|---|---|---|---|
| CAS Number | 6625-63-4 | Molecular Weight | 408.36100 | |
| Density | 1.29g/cm3 | Boiling Point | 510.9ºC at 760 mmHg | |
| Molecular Formula | C22H27Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.8ºC | |
| Name | 2-chloro-6-[[(3-chloro-2-hydroxy-5-methylphenyl)methyl-cyclohexylamino]methyl]-4-methylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 510.9ºC at 760 mmHg |
| Molecular Formula | C22H27Cl2NO2 |
| Molecular Weight | 408.36100 |
| Flash Point | 262.8ºC |
| Exact Mass | 407.14200 |
| PSA | 43.70000 |
| LogP | 6.35630 |
| Index of Refraction | 1.627 |
| InChIKey | PEQZDZSTBPUOHB-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)c(O)c(CN(Cc2cc(C)cc(Cl)c2O)C2CCCCC2)c1 |
|
~%
2-chloro-6-[[(3... CAS#:6625-63-4 |
| Literature: Burke,W.J. et al. Journal of Organic Chemistry, 1964 , vol. 29, p. 909 - 912 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N,N-Bis(3-chlor-2-hydroxy-5-methyl-benzyl)-cyclohexylamin |
| 2,2'-[(cyclohexylimino)dimethanediyl]bis(6-chloro-4-methylphenol) |