1-(4-bromophenyl)-2-(8-hydroxyquinolin-1-yl)ethanone structure
|
Common Name | 1-(4-bromophenyl)-2-(8-hydroxyquinolin-1-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 6625-22-5 | Molecular Weight | 423.09900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H13Br2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-bromophenyl)-2-(8-hydroxyquinolin-1-ium-1-yl)ethanone,bromide |
|---|
| Molecular Formula | C17H13Br2NO2 |
|---|---|
| Molecular Weight | 423.09900 |
| Exact Mass | 420.93100 |
| PSA | 41.18000 |
| LogP | 0.48230 |
| InChIKey | PDQSGKKYYSJTTQ-UHFFFAOYSA-N |
| SMILES | O=C(C[n+]1cccc2cccc(O)c21)c1ccc(Br)cc1.[Br-] |
|
~%
1-(4-bromopheny... CAS#:6625-22-5 |
| Literature: Bahner et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 4011 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |