1H-Inden-1-one,4-chloro-2,3-dihydro-7-hydroxy-3-methyl-
Modify Date: 2025-10-16 10:32:20
1H-Inden-1-one,4-chloro-2,3-dihydro-7-hydroxy-3-methyl- structure
|
Common Name | 1H-Inden-1-one,4-chloro-2,3-dihydro-7-hydroxy-3-methyl- | ||
|---|---|---|---|---|
| CAS Number | 6625-07-6 | Molecular Weight | 196.63000 | |
| Density | 1.352g/cm3 | Boiling Point | 309.1ºC at 760 mmHg | |
| Molecular Formula | C10H9ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140.8ºC | |
| Name | 4-chloro-7-hydroxy-3-methyl-2,3-dihydroinden-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.352g/cm3 |
|---|---|
| Boiling Point | 309.1ºC at 760 mmHg |
| Molecular Formula | C10H9ClO2 |
| Molecular Weight | 196.63000 |
| Flash Point | 140.8ºC |
| Exact Mass | 196.02900 |
| PSA | 37.30000 |
| LogP | 2.73550 |
| Index of Refraction | 1.604 |
| InChIKey | PPSMMWMVIIYEON-UHFFFAOYSA-N |
| SMILES | CC1CC(=O)c2c(O)ccc(Cl)c21 |
|
~%
1H-Inden-1-one,... CAS#:6625-07-6 |
| Literature: Hayes; Thomson Journal of the Chemical Society, 1956 , p. 1585,1588 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Chlor-7-hydroxy-3-methyl-indan-1-on |
| 4-chloro-7-hydroxy-3-methylindan-1-one |