(3-methoxybenzo[a]anthracen-12-yl) acetate structure
|
Common Name | (3-methoxybenzo[a]anthracen-12-yl) acetate | ||
|---|---|---|---|---|
| CAS Number | 66240-12-8 | Molecular Weight | 316.35000 | |
| Density | 1.248g/cm3 | Boiling Point | 530.5ºC at 760 mmHg | |
| Molecular Formula | C21H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.8ºC | |
| Name | (3-methoxybenzo[a]anthracen-12-yl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.248g/cm3 |
|---|---|
| Boiling Point | 530.5ºC at 760 mmHg |
| Molecular Formula | C21H16O3 |
| Molecular Weight | 316.35000 |
| Flash Point | 230.8ºC |
| Exact Mass | 316.11000 |
| PSA | 35.53000 |
| LogP | 5.08010 |
| Index of Refraction | 1.698 |
| InChIKey | JWCUXWWNYJFBSJ-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(ccc3cc4ccccc4c(OC(C)=O)c32)c1 |
|
~%
(3-methoxybenzo... CAS#:66240-12-8 |
| Literature: Harvey; Cortez; Sugiyama; Ito; Sawyer; DiGiovanni Journal of Medicinal Chemistry, 1988 , vol. 31, # 1 p. 154 - 159 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 12-acetoxy-3-methoxybenz[a]anthracene |
| 12-Acetoxy-3-methoxy-benz<a>anthracen |
| 3-Methoxybenz(a)anthracene-12-ol acetate |
| Benz(a)anthracene-12-ol,3-methoxy-,acetate |