(2E)-2-nitroso-2-(2-oxido-1-oxa-5-aza-2-azoniacyclopent-2-en-4-ylidene)-1-phenyl-ethanone
Modify Date: 2025-08-26 04:12:39
(2E)-2-nitroso-2-(2-oxido-1-oxa-5-aza-2-azoniacyclopent-2-en-4-ylidene)-1-phenyl-ethanone structure
|
Common Name | (2E)-2-nitroso-2-(2-oxido-1-oxa-5-aza-2-azoniacyclopent-2-en-4-ylidene)-1-phenyl-ethanone | ||
|---|---|---|---|---|
| CAS Number | 6624-50-6 | Molecular Weight | 233.18000 | |
| Density | 1.5g/cm3 | Boiling Point | 307.8ºC at 760 mmHg | |
| Molecular Formula | C10H7N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 140ºC | |
| Name | (2E)-2-nitroso-2-(5-oxido-1,2,5-oxadiazol-5-ium-3-ylidene)-1-phenylethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 307.8ºC at 760 mmHg |
| Molecular Formula | C10H7N3O4 |
| Molecular Weight | 233.18000 |
| Flash Point | 140ºC |
| Exact Mass | 233.04400 |
| PSA | 101.15000 |
| LogP | 1.16430 |
| Index of Refraction | 1.663 |
| InChIKey | YPUSGNPKSIAPMX-UHFFFAOYSA-N |
| SMILES | O=C(C(=NO)c1c[n+]([O-])on1)c1ccccc1 |
|
~%
(2E)-2-nitroso-... CAS#:6624-50-6 |
| Literature: Boyer,J.H.; Chang,M.S. Journal of the American Chemical Society, 1960 , vol. 82, p. 2220 - 2223 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| (5-oxy-furazan-3-yl)-phenyl-ethanedione 1-oxime |