3-methyl-7-morpholin-4-yl-6-nitro-quinazolin-4-one structure
|
Common Name | 3-methyl-7-morpholin-4-yl-6-nitro-quinazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 66234-56-8 | Molecular Weight | 290.27500 | |
| Density | 1.52g/cm3 | Boiling Point | 539.7ºC at 760 mmHg | |
| Molecular Formula | C13H14N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.2ºC | |
| Name | 3-methyl-7-morpholin-4-yl-6-nitroquinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 539.7ºC at 760 mmHg |
| Molecular Formula | C13H14N4O4 |
| Molecular Weight | 290.27500 |
| Flash Point | 280.2ºC |
| Exact Mass | 290.10200 |
| PSA | 93.18000 |
| LogP | 1.26650 |
| Index of Refraction | 1.696 |
| InChIKey | QESXONKCSJZNQQ-UHFFFAOYSA-N |
| SMILES | Cn1cnc2cc(N3CCOCC3)c([N+](=O)[O-])cc2c1=O |
|
~%
3-methyl-7-morp... CAS#:66234-56-8 |
| Literature: Roy,J. et al. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1978 , vol. 16, p. 41 - 44 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 3-methyl-7-morpholin-4-yl-6-nitro-quinazolin-4-one |
| 3-methyl-7-morpholin-4-yl-6-nitro-3H-quinazolin-4-one |
| 3-Methyl-6-nitro-7-morpholino-chinazolin-4-on |