2,6-bis[(4-hydroxy-3,5-dimethylphenyl)methyl]-4-methylphenol
Modify Date: 2025-09-05 09:59:51
![2,6-bis[(4-hydroxy-3,5-dimethylphenyl)methyl]-4-methylphenol Structure](https://image.chemsrc.com/caspic/031/66232-87-9.png)
2,6-bis[(4-hydroxy-3,5-dimethylphenyl)methyl]-4-methylphenol structure
|
Common Name | 2,6-bis[(4-hydroxy-3,5-dimethylphenyl)methyl]-4-methylphenol | ||
|---|---|---|---|---|
| CAS Number | 66232-87-9 | Molecular Weight | 376.48800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H28O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-bis[(4-hydroxy-3,5-dimethylphenyl)methyl]-4-methylphenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C25H28O3 |
|---|---|
| Molecular Weight | 376.48800 |
| Exact Mass | 376.20400 |
| PSA | 60.69000 |
| LogP | 5.52700 |
| InChIKey | CPIALDYHMPPRDJ-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cc2cc(C)c(O)c(C)c2)c(O)c(Cc2cc(C)c(O)c(C)c2)c1 |
| HS Code | 2907299090 |
|---|
|
~%
2,6-bis[(4-hydr... CAS#:66232-87-9 |
| Literature: Sprengling Journal of the American Chemical Society, 1954 , vol. 76, p. 1190 |
|
~%
2,6-bis[(4-hydr... CAS#:66232-87-9 |
| Literature: Ziegler Monatshefte fuer Chemie, 1948 , vol. 78, p. 334,340 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| 4-Hydroxy-1-methyl-3,5-bis-(4-hydroxy-3,5-dimethyl-benzyl)-benzol |
| 2,6-Bis-(4-hydroxy-3,5-dimethyl-benzyl)-4-methyl-phenol |