9,10-Anthracenedione,1,8-dichloro-4,5-dihydroxy-
Modify Date: 2025-08-27 10:41:05
9,10-Anthracenedione,1,8-dichloro-4,5-dihydroxy- structure
|
Common Name | 9,10-Anthracenedione,1,8-dichloro-4,5-dihydroxy- | ||
|---|---|---|---|---|
| CAS Number | 66227-51-8 | Molecular Weight | 309.10100 | |
| Density | 1.718g/cm3 | Boiling Point | 556.3ºC at 760 mmHg | |
| Molecular Formula | C14H6Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.2ºC | |
| Name | 1,8-dichloro-4,5-dihydroxyanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.718g/cm3 |
|---|---|
| Boiling Point | 556.3ºC at 760 mmHg |
| Molecular Formula | C14H6Cl2O4 |
| Molecular Weight | 309.10100 |
| Flash Point | 290.2ºC |
| Exact Mass | 307.96400 |
| PSA | 74.60000 |
| LogP | 3.18000 |
| Index of Refraction | 1.735 |
| InChIKey | FMYVSOYHWYHDAG-UHFFFAOYSA-N |
| SMILES | O=C1c2c(O)ccc(Cl)c2C(=O)c2c(Cl)ccc(O)c21 |
|
~%
9,10-Anthracene... CAS#:66227-51-8 |
| Literature: Bayer and Co. Patent: DE127699 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 6, p. 328 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,8-Dichlor-4,5-dihydroxy-anthrachinon |
| 1,8-dichloro-4,5-dihydroxyanthraquinone |
| 4,5-dichloro-1,8-dihydroxyanthraquinone |