4-bromo-6-[[(3-hydroxypyridin-2-yl)amino]methylidene]cyclohexa-2,4-dien-1-one structure
|
Common Name | 4-bromo-6-[[(3-hydroxypyridin-2-yl)amino]methylidene]cyclohexa-2,4-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 662167-96-6 | Molecular Weight | 293.11600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-bromo-6-[[(3-hydroxypyridin-2-yl)amino]methylidene]cyclohexa-2,4-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H9BrN2O2 |
|---|---|
| Molecular Weight | 293.11600 |
| Exact Mass | 291.98500 |
| PSA | 62.22000 |
| LogP | 2.57370 |
| InChIKey | AHCWOQDYYFOWDX-UHFFFAOYSA-N |
| SMILES | Oc1ccc(Br)cc1C=Nc1ncccc1O |
|
~90%
4-bromo-6-[[(3-... CAS#:662167-96-6 |
| Literature: Jain, Rajendra K.; Mishra, Anand P. Journal of the Serbian Chemical Society, 2012 , vol. 77, # 8 p. 1013 - 1029,17 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-(5-bromo-2-hydroxybenzylideneamino)pyridin-3-ol |
| 3-Pyridinol,2-[[(5-bromo-2-hydroxyphenyl)methylene]amino] |