Pyridinium,3-(aminocarbonyl)-1-[(4-nitrophenyl)methyl]-, chloride (1:1) structure
|
Common Name | Pyridinium,3-(aminocarbonyl)-1-[(4-nitrophenyl)methyl]-, chloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 6621-73-4 | Molecular Weight | 293.70600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[(4-nitrophenyl)methyl]pyridin-1-ium-3-carboxamide,chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H12ClN3O3 |
|---|---|
| Molecular Weight | 293.70600 |
| Exact Mass | 293.05700 |
| PSA | 92.79000 |
| Index of Refraction | 1.676 |
| InChIKey | YNLWJSQDCIUTGX-UHFFFAOYSA-N |
| SMILES | NC(=O)c1ccc[n+](Cc2ccc([N+](=O)[O-])cc2)c1.[Cl-] |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-carbamoyl-1-[(4-nitrophenyl)methyl]pyridin-1-ium chloride |
| 1-[(4-NITROPHENYL)METHYL]PYRIDIN-1-IUM-3-CARBOXAMIDE CHLORIDE |