ethyl 3-diethoxyphosphoryl-2-oxopropanoate
Modify Date: 2025-08-25 18:29:40
ethyl 3-diethoxyphosphoryl-2-oxopropanoate structure
|
Common Name | ethyl 3-diethoxyphosphoryl-2-oxopropanoate | ||
|---|---|---|---|---|
| CAS Number | 66187-85-7 | Molecular Weight | 252.20100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H17O6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 3-diethoxyphosphoryl-2-oxopropanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H17O6P |
|---|---|
| Molecular Weight | 252.20100 |
| Exact Mass | 252.07600 |
| PSA | 88.71000 |
| LogP | 1.38470 |
| InChIKey | BAQWHJCJMHTTOV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)CP(=O)(OCC)OCC |
|
~%
ethyl 3-diethox... CAS#:66187-85-7 |
| Literature: Kim, Dae Young; Kong, Myeon Sik; Lee, Kilsung Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1997 , # 9 p. 1360 - 1364 |
|
~%
ethyl 3-diethox... CAS#:66187-85-7 |
| Literature: Coutrot,P.; Savignac,P. Synthesis, 1978 , p. 36 - 38 |
|
~%
ethyl 3-diethox... CAS#:66187-85-7 |
| Literature: Aboujaoude, Elie Elia; Collignon, Noel; Savignac, Philippe Journal of Organometallic Chemistry, 1984 , vol. 264, # 1-2 p. 9 - 18 |
CAS#:113161-58-3| triethyl phosphonopyruvate |
| Ethyl-3-(diethoxyphosphoryl)-2-oxopropanoat |
| diethyl (2-ethoxycarbonyl)-2-oxoethylphosphonate |
| diethoxyphosphoryl-pyruvic acid ethyl ester |
| Diaethoxyphosphoryl-brenztraubensaeure-aethylester |
| Propanoic acid,3-(diethoxyphosphinyl)-2-oxo-,ethyl ester |