eglinazine-ethyl
Modify Date: 2025-09-15 18:39:30
eglinazine-ethyl structure
|
Common Name | eglinazine-ethyl | ||
|---|---|---|---|---|
| CAS Number | 6616-80-4 | Molecular Weight | 259.69300 | |
| Density | 1.37g/cm3 | Boiling Point | 434.4ºC at 760 mmHg | |
| Molecular Formula | C9H14ClN5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.5ºC | |
| Name | eglinazine-ethyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 434.4ºC at 760 mmHg |
| Molecular Formula | C9H14ClN5O2 |
| Molecular Weight | 259.69300 |
| Flash Point | 216.5ºC |
| Exact Mass | 259.08400 |
| PSA | 91.24000 |
| LogP | 0.94070 |
| Index of Refraction | 1.601 |
| InChIKey | YESXTECNXIKUMM-UHFFFAOYSA-N |
| SMILES | CCNc1nc(Cl)nc(NCC(=O)OCC)n1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| eglinazine |
| MG-06 |
| EGLINAZINE-ETHYL |
| ethyl N-(4-chloro-6-ethylamino-1,3,5-triazin-2-yl)glycinate |
| ethyl N-[4-chloro-6-(ethylamino)-1,3,5-triazin-2-yl]glycinate |