4-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]benzenesulfonamide
Modify Date: 2024-01-23 11:10:30
![4-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]benzenesulfonamide Structure](https://image.chemsrc.com/caspic/310/66121-83-3.png)
4-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]benzenesulfonamide structure
|
Common Name | 4-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 66121-83-3 | Molecular Weight | 345.43900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15N3O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino]benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H15N3O2S2 |
|---|---|
| Molecular Weight | 345.43900 |
| Exact Mass | 345.06100 |
| PSA | 121.70000 |
| LogP | 5.36360 |
| InChIKey | VLPSIAJKWCMGRJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2csc(Nc3ccc(S(N)(=O)=O)cc3)n2)cc1 |
|
~%
4-[[4-(4-methyl... CAS#:66121-83-3 |
| Literature: Shingare; Ingle Journal of the Indian Chemical Society, 1977 , vol. 54, # 7 p. 705 - 708 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-{[4-(4-methylphenyl)-1,3-thiazol-2-yl]amino}benzenesulfonamide |
| 4-(4-p-tolyl-thiazol-2-ylamino)-benzenesulfonamide |