2,4-dibromo-1-(2,4-dibromophenyl)benzene structure
|
Common Name | 2,4-dibromo-1-(2,4-dibromophenyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 66115-57-9 | Molecular Weight | 469.79200 | |
| Density | 2.14g/cm3 | Boiling Point | 413.7ºC at 760 mmHg | |
| Molecular Formula | C12H6Br4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.4ºC | |
| Name | 2,4-dibromo-1-(2,4-dibromophenyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.14g/cm3 |
|---|---|
| Boiling Point | 413.7ºC at 760 mmHg |
| Molecular Formula | C12H6Br4 |
| Molecular Weight | 469.79200 |
| Flash Point | 197.4ºC |
| Exact Mass | 465.72000 |
| LogP | 6.40360 |
| Index of Refraction | 1.666 |
| InChIKey | UBJWRBZIWNERQZ-UHFFFAOYSA-N |
| SMILES | Brc1ccc(-c2ccc(Br)cc2Br)c(Br)c1 |
|
~%
2,4-dibromo-1-(... CAS#:66115-57-9 |
| Literature: Loh; Turner Journal of the Chemical Society, 1955 , p. 1274,1277 |
|
~%
2,4-dibromo-1-(... CAS#:66115-57-9 |
| Literature: Loh; Turner Journal of the Chemical Society, 1955 , p. 1274,1277 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,4,2',4'-Tetrabrom-biphenyl |
| 2,4,2',4'-tetrabromo-biphenyl |
| 2,2',4,4'-Tetrabromobiphenyl |