4-Bromophenyl triflate structure
|
Common Name | 4-Bromophenyl triflate | ||
|---|---|---|---|---|
| CAS Number | 66107-30-0 | Molecular Weight | 305.06900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H4BrF3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-Bromophenyl trifluoromethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H4BrF3O3S |
|---|---|
| Molecular Weight | 305.06900 |
| Exact Mass | 303.90200 |
| PSA | 51.75000 |
| LogP | 3.75830 |
| InChIKey | UNYUEWLAYXLXHK-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Oc1ccc(Br)cc1)C(F)(F)F |
|
~94%
4-Bromophenyl t... CAS#:66107-30-0 |
| Literature: Jolly, Phillip I.; Fleary-Roberts, Nadia; O'Sullivan, Steven; Doni, Eswararao; Zhou, Shengze; Murphy, John A. Organic and Biomolecular Chemistry, 2012 , vol. 10, # 30 p. 5807 - 5810 |
|
~%
4-Bromophenyl t... CAS#:66107-30-0 |
| Literature: Herbert, John M.; Kohler, Andrew D.; Le Strat, Franck; Whitehead, David Journal of Labelled Compounds and Radiopharmaceuticals, 2007 , vol. 50, # 5-6 p. 440 - 441 |
| Precursor 3 | |
|---|---|
| DownStream 10 | |
| 4-(tert-butyldimethylsilyloxy)cyclohex-1-enyl trifluoromethanesulfonate |
| 4-bromophenyl triflate |
| [4-[tert-butyl(dimethyl)silyl]oxycyclohexen-1-yl] tris(fluoranyl)methanesulfonate |
| 4-((tert-butyl(dimethyl)silyl)oxy)-1-cyclohexen-1-yl trifluoromethanesulfonate |
| trifluoromethanesulfonic acid p-bromophenyl ester |
| 4-((tert-Butyldimethylsilyl)oxy)cyclohex-1-en-1-yl trifluoromethanesulfonate |
| 4-bromophenyltrifluoromethanesulfonate |
| trifluoromethanesulfonic acid [4-[tert-butyl(dimethyl)silyl]oxy-1-cyclohexenyl] ester |
| trifluoromethanesulfonic acid 4-(tert-butyldimethylsilanyloxy)cyclohex-1-enyl ester |
| p-bromophenyl triflate |
| trifluoromethanesulfonic acid 4-bromophenyl ester |