2-[(2-methoxy-4-nitrophenyl)amino]ethanol structure
|
Common Name | 2-[(2-methoxy-4-nitrophenyl)amino]ethanol | ||
|---|---|---|---|---|
| CAS Number | 66095-81-6 | Molecular Weight | 212.20300 | |
| Density | 1.336g/cm3 | Boiling Point | 406.5ºC at 760 mmHg | |
| Molecular Formula | C9H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-methoxy-4-nitroanilino)ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.336g/cm3 |
|---|---|
| Boiling Point | 406.5ºC at 760 mmHg |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20300 |
| Exact Mass | 212.08000 |
| PSA | 87.31000 |
| LogP | 1.60380 |
| Index of Refraction | 1.612 |
| InChIKey | DZFVBIGUJAYIFJ-UHFFFAOYSA-N |
| SMILES | COc1cc([N+](=O)[O-])ccc1NCCO |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Hydroxyethylamino-5-nitroanisole |
| 2-(4-Nitro-o-anisidino)ethanol |
| EINECS 266-138-0 |
| 1-methoxy-2-(2'-hydroxyethyl)-amino-5-nitrobenzene |
| 1-hydroxyethylamino-5-nitroanisole |
| 2-[(2-methoxy-4-nitrophenyl)amino]ethanol |
| N-(2-hydroxyethyl)-2-methoxy-4-nitroaniline |