(4-tert-butylsulfanylphenyl)-phenylmethanone
Modify Date: 2025-09-01 14:00:40
(4-tert-butylsulfanylphenyl)-phenylmethanone structure
|
Common Name | (4-tert-butylsulfanylphenyl)-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 66084-79-5 | Molecular Weight | 270.38900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-tert-butylsulfanylphenyl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H18OS |
|---|---|
| Molecular Weight | 270.38900 |
| Exact Mass | 270.10800 |
| PSA | 42.37000 |
| LogP | 4.80820 |
| InChIKey | RRZXMXMSGKYJLB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)Sc1ccc(C(=O)c2ccccc2)cc1 |
|
~91%
(4-tert-butylsu... CAS#:66084-79-5 |
| Literature: Arisawa, Mieko; Ichikawa, Takuya; Yamaguchi, Masahiko Organic Letters, 2012 , vol. 14, # 20 p. 5318 - 5321 |
|
~%
(4-tert-butylsu... CAS#:66084-79-5 |
| Literature: Amatore; Pinson; Saveant; Thiebault Journal of the American Chemical Society, 1982 , vol. 104, # 3 p. 817 - 826 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| p-benzoylphenyl butyl sulfide |
| 4-Thio-tert.-butylbenzophenon |
| Methanone,[4-[(1,1-dimethylethyl)thio]phenyl]phenyl |