3,4-Dimethoxybenzoic acid [3,7-dimethyl-5-oxo-2,6-octadienyl] ester structure
|
Common Name | 3,4-Dimethoxybenzoic acid [3,7-dimethyl-5-oxo-2,6-octadienyl] ester | ||
|---|---|---|---|---|
| CAS Number | 66067-31-0 | Molecular Weight | 332.39100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H24O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3,7-dimethyl-5-oxoocta-2,6-dienyl) 3,4-dimethoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H24O5 |
|---|---|
| Molecular Weight | 332.39100 |
| Exact Mass | 332.16200 |
| PSA | 61.83000 |
| LogP | 3.73230 |
| InChIKey | SCMSOXISMWKAIZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)OCC=C(C)CC(=O)C=C(C)C)cc1OC |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3,4-Dimethoxybenzoic acid [3,7-dimethyl-5-oxo-2,6-octadienyl] ester |