(2,5-dimethylphenyl) N-phenylcarbamate
Modify Date: 2025-10-16 18:37:02
(2,5-dimethylphenyl) N-phenylcarbamate structure
|
Common Name | (2,5-dimethylphenyl) N-phenylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 66018-79-9 | Molecular Weight | 241.28500 | |
| Density | 1.165g/cm3 | Boiling Point | 353.1ºC at 760 mmHg | |
| Molecular Formula | C15H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.3ºC | |
| Name | (2,5-dimethylphenyl) N-phenylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.165g/cm3 |
|---|---|
| Boiling Point | 353.1ºC at 760 mmHg |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.28500 |
| Flash Point | 167.3ºC |
| Exact Mass | 241.11000 |
| PSA | 38.33000 |
| LogP | 3.98730 |
| Index of Refraction | 1.61 |
| InChIKey | PVVMDLAHKBYBFL-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C)c(OC(=O)Nc2ccccc2)c1 |
| HS Code | 2924299090 |
|---|
|
~%
(2,5-dimethylph... CAS#:66018-79-9 |
| Literature: Auwers Chemische Berichte, 1899 , vol. 32, p. 19 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,5-Dimethylphenyl-N-phenylcarbamate |
| 2,5-dimethylphenyl phenylcarbamate |
| Phenol,5-dimethyl-,phenylcarbamate |