((6,7-dichloro-2-(4-fluorophenyl)-2-methyl-1-oxo-5-indanyl)oxy)acetic acid
Modify Date: 2025-10-26 08:59:01
((6,7-dichloro-2-(4-fluorophenyl)-2-methyl-1-oxo-5-indanyl)oxy)acetic acid structure
|
Common Name | ((6,7-dichloro-2-(4-fluorophenyl)-2-methyl-1-oxo-5-indanyl)oxy)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 66015-25-6 | Molecular Weight | 383.19800 | |
| Density | 1.468g/cm3 | Boiling Point | 548.6ºC at 760 mmHg | |
| Molecular Formula | C18H13Cl2FO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285.6ºC | |
| Name | 2-[[6,7-dichloro-2-(4-fluorophenyl)-2-methyl-1-oxo-3H-inden-5-yl]oxy]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.468g/cm3 |
|---|---|
| Boiling Point | 548.6ºC at 760 mmHg |
| Molecular Formula | C18H13Cl2FO4 |
| Molecular Weight | 383.19800 |
| Flash Point | 285.6ºC |
| Exact Mass | 382.01700 |
| PSA | 63.60000 |
| LogP | 4.29260 |
| Index of Refraction | 1.608 |
| InChIKey | DPESQQIBUVKMFX-UHFFFAOYSA-N |
| SMILES | CC1(c2ccc(F)cc2)Cc2cc(OCC(=O)O)c(Cl)c(Cl)c2C1=O |
|
~%
((6,7-dichloro-... CAS#:66015-25-6 |
| Literature: Merck and Co., Inc. Patent: US4096267 A1, 1978 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Dfmoiaa |
| {[6,7-dichloro-2-(4-fluorophenyl)-2-methyl-1-oxo-2,3-dihydro-1h-inden-5-yl]oxy}acetic acid |
| [1-oxo-2-(4-fluorophenyl)-2-methyl-6,7-dichloro-5-indanyloxy]acetic acid |
| ((6,7-Dichloro-2-(4-fluorophenyl)-2-methyl-1-oxo-5-indanyl)oxy)acetic acid |