2-benzyl-3-methyl-4-oxido-quinoxaline 1-oxide structure
|
Common Name | 2-benzyl-3-methyl-4-oxido-quinoxaline 1-oxide | ||
|---|---|---|---|---|
| CAS Number | 65990-96-7 | Molecular Weight | 266.29500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-benzyl-3-methyl-4-oxidoquinoxalin-1-ium 1-oxide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H14N2O2 |
|---|---|
| Molecular Weight | 266.29500 |
| Exact Mass | 266.10600 |
| PSA | 50.92000 |
| LogP | 3.59600 |
| InChIKey | DKSRBWOIQVNXQO-UHFFFAOYSA-N |
| SMILES | Cc1c(Cc2ccccc2)[n+](=O)c2ccccc2n1[O-] |
|
~%
2-benzyl-3-meth... CAS#:65990-96-7 |
| Literature: Vicente, Esther; Villar, Raquel; Burguete, Asuncion; Solano, Beatriz; Ancizu, Saioa; Perez-Silanes, Silvia; Aldana, Ignacio; Monge, Antonio Molecules, 2008 , vol. 13, # 1 p. 86 - 95 |
|
~%
2-benzyl-3-meth... CAS#:65990-96-7 |
| Literature: Landquist; Stacey Journal of the Chemical Society, 1953 , p. 2822,2827 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-benzyl-3-methyl-quinoxaline 1,4-dioxide |
| 2-Benzyl-3-methyl-chinoxalin-1,4-dioxid |
| 2-benzyl-3-methylquinoxaline 1,4-di-N-oxide |