[[amino-[(benzylideneamino)-methyl-amino]methylidene]amino]-hydroxy-oxo-azanium
Modify Date: 2025-10-04 18:04:53
![[[amino-[(benzylideneamino)-methyl-amino]methylidene]amino]-hydroxy-oxo-azanium Structure](https://image.chemsrc.com/caspic/055/65943-80-8.png)
[[amino-[(benzylideneamino)-methyl-amino]methylidene]amino]-hydroxy-oxo-azanium structure
|
Common Name | [[amino-[(benzylideneamino)-methyl-amino]methylidene]amino]-hydroxy-oxo-azanium | ||
|---|---|---|---|---|
| CAS Number | 65943-80-8 | Molecular Weight | 221.21600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[(E)-benzylideneamino]-1-methyl-2-nitroguanidine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H11N5O2 |
|---|---|
| Molecular Weight | 221.21600 |
| Exact Mass | 221.09100 |
| PSA | 99.80000 |
| LogP | 1.68220 |
| InChIKey | QFJHLZJPOHJAFV-XFFZJAGNSA-N |
| SMILES | CN(N=Cc1ccccc1)C(N)=N[N+](=O)[O-] |
|
~%
[[amino-[(benzy... CAS#:65943-80-8 |
| Literature: Henry et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 5693 |
|
~%
[[amino-[(benzy... CAS#:65943-80-8 |
| Literature: Henry; Smith Journal of the American Chemical Society, 1951 , vol. 73, p. 1858 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-benzylidenamino-N-methyl-N'-nitro-guanidine |
| 1-Benzylideneamino-1-methyl-2-nitroguanidine |
| Hydrazinecarboximidamide,1-methyl-N-nitro-2-(phenylmethylene) |