Tris(2,2,2-trifluoroethyl) borate structure
|
Common Name | Tris(2,2,2-trifluoroethyl) borate | ||
|---|---|---|---|---|
| CAS Number | 659-18-7 | Molecular Weight | 307.907 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 94.3±40.0 °C at 760 mmHg | |
| Molecular Formula | C6H6BF9O3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 10.8±27.3 °C | |
| Name | Tris(2,2,2-trifluoroethyl) Borate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 94.3±40.0 °C at 760 mmHg |
| Molecular Formula | C6H6BF9O3 |
| Molecular Weight | 307.907 |
| Flash Point | 10.8±27.3 °C |
| Exact Mass | 308.026642 |
| PSA | 27.69000 |
| LogP | 5.36 |
| Vapour Pressure | 54.3±0.2 mmHg at 25°C |
| Index of Refraction | 1.293 |
| InChIKey | DIEXQJFSUBBIRP-UHFFFAOYSA-N |
| SMILES | FC(F)(F)COB(OCC(F)(F)F)OCC(F)(F)F |
| HS Code | 2920909090 |
|---|
|
~90%
Tris(2,2,2-trif... CAS#:659-18-7 |
| Literature: Starkov, Pavel; Sheppard, Tom D. Organic and Biomolecular Chemistry, 2011 , vol. 9, # 5 p. 1320 - 1323 |
|
~34%
Tris(2,2,2-trif... CAS#:659-18-7 |
| Literature: Shaw, S. Yvette; Neilson, Robert H. Inorganic Chemistry, 1991 , vol. 30, p. 148 - 150 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Tris(2,2,2-trifluoroethyl) borate |