Glabrescione B structure
|
Common Name | Glabrescione B | ||
|---|---|---|---|---|
| CAS Number | 65893-94-9 | Molecular Weight | 450.52400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H30O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Glabrescione BGlabrescione B is the first compound that binds the Hedgehog (Hh) modulator Gli1. Glabrescione B impairs its activity by interfering with Gli1-DNA interaction. Glabrescione B inhibits the growth of Hedgehog-dependent tumor cells, the self-renewal ability, and clonogenicity of tumor-derived stem cells[1][2]. |
| Name | glabrescione B |
|---|---|
| Synonym | More Synonyms |
| Description | Glabrescione B is the first compound that binds the Hedgehog (Hh) modulator Gli1. Glabrescione B impairs its activity by interfering with Gli1-DNA interaction. Glabrescione B inhibits the growth of Hedgehog-dependent tumor cells, the self-renewal ability, and clonogenicity of tumor-derived stem cells[1][2]. |
|---|---|
| Related Catalog | |
| Target |
Gli1-DNA Interaction[1] |
| In Vitro | Glabrescione B (5 μM; 24-72 hours) inhibits the growth of Gli-dependent basal cell carcinoma[2]. Glabrescione B (1-10 μM; 24-48 hours) decreases Gli1 mRNA expression levels[2]. Cell Proliferation Assay[1] Cell Line: ASZ001 BCC cells Concentration: 5 μM Incubation Time: 24-72 hours Result: Basal cell carcinoma cell proliferation was impaired. Western Blot Analysis[1] Cell Line: ASZ001 BCC cells Concentration: 1-10 μM Incubation Time: 24-48 hours Result: Gli1 mRNA expression levels was decreased. |
| In Vivo | Animal Model: Female NOD/SCID mice (ASZ001 BCC allografts)[2] Dosage: 100 μmol/kg Administration: I.p.; every second day for 18 days Result: A significant reduction of tumor growth as well as Gli1 mRNA levels was observed. |
| References |
| Molecular Formula | C27H30O6 |
|---|---|
| Molecular Weight | 450.52400 |
| Exact Mass | 450.20400 |
| PSA | 67.13000 |
| LogP | 6.16720 |
| InChIKey | RHXDATRKLOYVTC-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c2c(=O)c(-c3ccc(OCC=C(C)C)c(OCC=C(C)C)c3)coc2c1 |
| 3-[3,4-bis-(3-methyl-but-2-enyloxy)-phenyl]-5,7-dimethoxy-chromen-4-one |
| Glabrescion B |
| 3-[3,4-Bis-(3-methyl-but-2-enyloxy)-phenyl]-5,7-dimethoxy-chromen-4-one |
| 3-(3',4'-bis(3-methylbut-2-enyloxy)phenyl)-5,7-dimethoxy-4H-chromen-4-one |