2,2'-[p-phenylenebis(methylene)]bis[5,5-dimethyl-1,3,2-dioxaphosphorinane] 2,2'-dioxide structure
|
Common Name | 2,2'-[p-phenylenebis(methylene)]bis[5,5-dimethyl-1,3,2-dioxaphosphorinane] 2,2'-dioxide | ||
|---|---|---|---|---|
| CAS Number | 65850-52-4 | Molecular Weight | 683.16300 | |
| Density | 1.23g/cm3 | Boiling Point | 513ºC at 760 mmHg | |
| Molecular Formula | C14H20HgN4Na2O4S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.1ºC | |
| Name | disodium,bis[[4-(carboxylatomethyl)piperazin-1-yl]sulfanylcarbothioyl]mercury |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 513ºC at 760 mmHg |
| Molecular Formula | C14H20HgN4Na2O4S4 |
| Molecular Weight | 683.16300 |
| Flash Point | 277.1ºC |
| Exact Mass | 683.98700 |
| PSA | 208.00000 |
| Index of Refraction | 1.518 |
| InChIKey | HEJAJPLMZFPDTC-UHFFFAOYSA-N |
| SMILES | CC1(C)COP(=O)(Cc2ccc(CP3(=O)OCC(C)(C)CO3)cc2)OC1 |
| disodium bis({[4-(carboxylatomethyl)piperazin-1-yl]sulfanyl}carbothioyl)mercury |
| Sodium salt of mercury dithiocarbamate piperazine acetic acid |
| Mercury(2-),bis(4-(dithiocarboxy)-1-piperazineacetato(2-))-,disodium |
| disodium bis[[4-(2-oxido-2-oxoethyl)piperazin-1-yl]sulfanylcarbothioyl]mercury |