bis[3-(trifluoromethyl)phenyl]phosphane
Modify Date: 2025-08-26 23:14:15
![bis[3-(trifluoromethyl)phenyl]phosphane Structure](https://image.chemsrc.com/caspic/208/65796-64-7.png)
bis[3-(trifluoromethyl)phenyl]phosphane structure
|
Common Name | bis[3-(trifluoromethyl)phenyl]phosphane | ||
|---|---|---|---|---|
| CAS Number | 65796-64-7 | Molecular Weight | 322.18500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H9F6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis[3-(trifluoromethyl)phenyl]phosphane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H9F6P |
|---|---|
| Molecular Weight | 322.18500 |
| Exact Mass | 322.03500 |
| PSA | 13.59000 |
| LogP | 4.35350 |
| InChIKey | SLEAUGLJRCPRES-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cccc(Pc2cccc(C(F)(F)F)c2)c1 |
|
~91%
bis[3-(trifluor... CAS#:65796-64-7 |
| Literature: Hobbs, Charles F.; Knowles, W. S. Journal of Organic Chemistry, 1981 , vol. 46, p. 4422 - 4427 |
|
~%
bis[3-(trifluor... CAS#:65796-64-7 |
| Literature: Hobbs, Charles F.; Knowles, W. S. Journal of Organic Chemistry, 1981 , vol. 46, p. 4422 - 4427 |
|
~%
bis[3-(trifluor... CAS#:65796-64-7 |
| Literature: Kapoor,P.N.; Venanzi,L.M. Helvetica Chimica Acta, 1977 , vol. 60, # 277 p. 2824 - 2829 |
![oxo-bis[3-(trifluoromethyl)phenyl]phosphanium structure](https://image.chemsrc.com/caspic/305/15929-44-9.png)
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Bis-<3-trifluormethyl-phenyl>-phosphin |
| bis(trifluoromethylphenyl)phosphine |
| di(m-trifluoromethylphenyl)phosphane |
| di((m-trifluoromethyl)phenyl)phosphine |
| Phosphine,bis[3-(trifluoromethyl)phenyl] |
| bis(m-trifluoromethylphenyl)phosphine |
| bis(3-trifluoromethylphenyl)phosphine |