2,5-Anhydro-1,3-O-isopropylidene-6-O-trityl-D-glucitol
Modify Date: 2025-08-24 18:22:02
2,5-Anhydro-1,3-O-isopropylidene-6-O-trityl-D-glucitol structure
|
Common Name | 2,5-Anhydro-1,3-O-isopropylidene-6-O-trityl-D-glucitol | ||
|---|---|---|---|---|
| CAS Number | 65758-50-1 | Molecular Weight | 432.50800 | |
| Density | 1.172g/cm3 | Boiling Point | 576.083ºC at 760 mmHg | |
| Molecular Formula | C27H28O5 | Melting Point | 185-186ºC | |
| MSDS | N/A | Flash Point | 302.204ºC | |
| Name | 2,5-Anhydro-1,3-O-isopropylidene-6-O-trityl-D-glucitol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.172g/cm3 |
|---|---|
| Boiling Point | 576.083ºC at 760 mmHg |
| Melting Point | 185-186ºC |
| Molecular Formula | C27H28O5 |
| Molecular Weight | 432.50800 |
| Flash Point | 302.204ºC |
| Exact Mass | 432.19400 |
| PSA | 57.15000 |
| LogP | 4.23240 |
| Index of Refraction | 1.572 |
| InChIKey | BVJKCDWHERTVGS-XDZVQPMWSA-N |
| SMILES | CC1(C)OCC2OC(COC(c3ccccc3)(c3ccccc3)c3ccccc3)C(O)C2O1 |
|
~%
2,5-Anhydro-1,3... CAS#:65758-50-1 |
| Literature: Doboszewski, Bogdan Nucleosides, Nucleotides and Nucleic Acids, 2009 , vol. 28, # 10 p. 875 - 901 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:27826-73-9| (4aS,6R,7S)-2,2-dimethyl-6-(trityloxymethyl)-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3]dioxin-7-ol |