6-methyl-2-(trifluoromethyl)-1H-pyrimidine-4-thione
Modify Date: 2025-09-13 16:43:25
6-methyl-2-(trifluoromethyl)-1H-pyrimidine-4-thione structure
|
Common Name | 6-methyl-2-(trifluoromethyl)-1H-pyrimidine-4-thione | ||
|---|---|---|---|---|
| CAS Number | 657-50-1 | Molecular Weight | 194.17800 | |
| Density | 1.47g/cm3 | Boiling Point | 163.9ºC at 760mmHg | |
| Molecular Formula | C6H5F3N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-methyl-2-(trifluoromethyl)-1H-pyrimidine-4-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 163.9ºC at 760mmHg |
| Molecular Formula | C6H5F3N2S |
| Molecular Weight | 194.17800 |
| Exact Mass | 194.01300 |
| PSA | 60.77000 |
| LogP | 2.46640 |
| Index of Refraction | 1.534 |
| InChIKey | LPFRMDWRSJOKFR-UHFFFAOYSA-N |
| SMILES | Cc1cc(=S)nc(C(F)(F)F)[nH]1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-methyl-2-trifluoromethyl-3H-pyrimidine-4-thione |
| 6-Mercapto-4-methyl-2-trifluormethyl-pyrimidin |