3-chloro-7-(trifluoromethyl)-1H-quinolin-4-one
Modify Date: 2025-08-25 21:22:34
3-chloro-7-(trifluoromethyl)-1H-quinolin-4-one structure
|
Common Name | 3-chloro-7-(trifluoromethyl)-1H-quinolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 65673-93-0 | Molecular Weight | 247.60100 | |
| Density | 1.541g/cm3 | Boiling Point | 307.6ºC at 760 mmHg | |
| Molecular Formula | C10H5ClF3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.9ºC | |
| Name | 3-chloro-7-(trifluoromethyl)-1H-quinolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.541g/cm3 |
|---|---|
| Boiling Point | 307.6ºC at 760 mmHg |
| Molecular Formula | C10H5ClF3NO |
| Molecular Weight | 247.60100 |
| Flash Point | 139.9ºC |
| Exact Mass | 247.00100 |
| PSA | 33.12000 |
| LogP | 3.61260 |
| Index of Refraction | 1.586 |
| InChIKey | KMRLVUZYOOBTFZ-UHFFFAOYSA-N |
| SMILES | O=c1c(Cl)c[nH]c2cc(C(F)(F)F)ccc12 |
| HS Code | 2933499090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:3689-24-5| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-CHLORO-7-TRIFLUOROMETHYLQUINOLIN-4-OL |
| 3-Chlor-4-hydroxy-7-trifluormethylchinolin |
| 3-Chloro-4-hydroxy-7-trifluoromethylquinoline |