hexane-1,6-diol, compound with N-ethyldibutylamine (1:2)
Modify Date: 2025-09-21 12:34:44
hexane-1,6-diol, compound with N-ethyldibutylamine (1:2) structure
|
Common Name | hexane-1,6-diol, compound with N-ethyldibutylamine (1:2) | ||
|---|---|---|---|---|
| CAS Number | 65652-34-8 | Molecular Weight | 432.76700 | |
| Density | N/A | Boiling Point | 182.8ºC at 760 mmHg | |
| Molecular Formula | C26H60N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 52.6ºC | |
| Name | N-butyl-N-ethylbutan-1-amine,hexane-1,6-diol |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 182.8ºC at 760 mmHg |
|---|---|
| Molecular Formula | C26H60N2O2 |
| Molecular Weight | 432.76700 |
| Flash Point | 52.6ºC |
| Exact Mass | 432.46500 |
| PSA | 46.94000 |
| LogP | 6.34840 |
| InChIKey | HHBUMQWRCZAUOD-UHFFFAOYSA-N |
| SMILES | CCCCN(CC)CCCC.CCCCN(CC)CCCC.OCCCCCCO |
| EINECS 265-858-2 |
| 1,6-Hexanediol,compd. with N-butyl-N-ethyl-1-butanamine (1:2) |
| Hexane-1,6-diol,compound with N-ethyldibutylamine (1:2) |