1-(2-oxochromen-3-yl)-3-phenylthiourea
Modify Date: 2025-08-27 09:08:49
1-(2-oxochromen-3-yl)-3-phenylthiourea structure
|
Common Name | 1-(2-oxochromen-3-yl)-3-phenylthiourea | ||
|---|---|---|---|---|
| CAS Number | 65612-46-6 | Molecular Weight | 296.34400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-oxochromen-3-yl)-3-phenylthiourea |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H12N2O2S |
|---|---|
| Molecular Weight | 296.34400 |
| Exact Mass | 296.06200 |
| PSA | 93.40000 |
| LogP | 3.89540 |
| InChIKey | RCQZNGOYHXTWAP-UHFFFAOYSA-N |
| SMILES | O=c1oc2ccccc2cc1NC(=S)Nc1ccccc1 |
|
~82%
1-(2-oxochromen... CAS#:65612-46-6 |
| Literature: Sen; Srivastava Journal of the Indian Chemical Society, 1989 , vol. 66, # 3 p. 166 - 168 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Thiourea,N-(2-oxo-2H-1-benzopyran-3-yl)-N'-phenyl |